C20H29NO7 — CID 59375299
1-O-tert-butyl 3-O-methyl (3R,4S,5S)-5-hydroxy-4-[3-(methoxymethoxy)phenyl]piperidine-1,3-dicarboxylate (PubChem CID 59375299) has the molecular formula C20H29NO7 and a molecular weight of 395.45 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl (3R,4S,5S)-5-hydroxy-4-[3-(methoxymethoxy)phenyl]piperidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-methyl (3R,4S,5S)-5-hydroxy-4-[3-(methoxymethoxy)phenyl]piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 59375299 |
| Molecular Formula | C20H29NO7 |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl (3R,4S,5S)-5-hydroxy-4-[3-(methoxymethoxy)phenyl]piperidine-1,3-dicarboxylate |
| SMILES | COCOc1cccc([C@H]2[C@H](O)CN(C(=O)OC(C)(C)C)C[C@@H]2C(=O)OC)c1 |
| InChI | InChI=1S/C20H29NO7/c1-20(2,3)28-19(24)21-10-15(18(23)26-5)17(16(22)11-21)13-7-6-8-14(9-13)27-12-25-4/h6-9,15-17,22H,10-12H2,1-5H3/t15-,16+,17+/m0/s1 |
| InChIKey | CIJNGNKOPBYYMR-GVDBMIGSSA-N |
| XLogP | 2.15 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|