About 9-bromo-6-(3,3-difluorocyclobutyl)-2H-benzo[c][1,6]naphthyridin-1-one
9-bromo-6-(3,3-difluorocyclobutyl)-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 59375439) has the molecular formula C16H11BrF2N2O
and a molecular weight of 365.18 g/mol. Its IUPAC name is 9-bromo-6-(3,3-difluorocyclobutyl)-2H-benzo[c][1,6]naphthyridin-1-one.
Molecular Properties
| Compound Name | 9-bromo-6-(3,3-difluorocyclobutyl)-2H-benzo[c][1,6]naphthyridin-1-one |
| PubChem CID | 59375439 |
| Molecular Formula | C16H11BrF2N2O |
| Molecular Weight | 365.18 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | 9-bromo-6-(3,3-difluorocyclobutyl)-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | O=c1[nH]ccc2nc(C3CC(F)(F)C3)c3ccc(Br)cc3c12 |
| InChI | InChI=1S/C16H11BrF2N2O/c17-9-1-2-10-11(5-9)13-12(3-4-20-15(13)22)21-14(10)8-6-16(18,19)7-8/h1-5,8H,6-7H2,(H,20,22) |
| InChIKey | YIUXPDLBKDMDRH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.18 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 9-bromo-6-(3,3-difluorocyclobutyl)-2H-benzo[c][1,6]naphthyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromo-6-(3,3-difluorocyclobutyl)-2H-benzo[c][1,6]naphthyridin-1-one?
The IUPAC name of 9-bromo-6-(3,3-difluorocyclobutyl)-2H-benzo[c][1,6]naphthyridin-1-one (CID 59375439) is 9-bromo-6-(3,3-difluorocyclobutyl)-2H-benzo[c][1,6]naphthyridin-1-one.
What is the SMILES notation for 9-bromo-6-(3,3-difluorocyclobutyl)-2H-benzo[c][1,6]naphthyridin-1-one?
The canonical SMILES for 9-bromo-6-(3,3-difluorocyclobutyl)-2H-benzo[c][1,6]naphthyridin-1-one is O=c1[nH]ccc2nc(C3CC(F)(F)C3)c3ccc(Br)cc3c12.
What is the InChIKey of 9-bromo-6-(3,3-difluorocyclobutyl)-2H-benzo[c][1,6]naphthyridin-1-one?
The InChIKey is YIUXPDLBKDMDRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11BrF2N2O/c17-9-1-2-10-11(5-9)13-12(3-4-20-15(13)22)21-14(10)8-6-16(18,19)7-8/h1-5,8H,6-7H2,(H,20,22).
What are the key properties of 9-bromo-6-(3,3-difluorocyclobutyl)-2H-benzo[c][1,6]naphthyridin-1-one?
9-bromo-6-(3,3-difluorocyclobutyl)-2H-benzo[c][1,6]naphthyridin-1-one has a molecular weight of 365.18 g/mol, XLogP of 4.35, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromo-6-(3,3-difluorocyclobutyl)-2H-benzo[c][1,6]naphthyridin-1-one is sourced from PubChem (CID 59375439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).