C17H14BrClF3N3 — CID 59375530
9-bromo-1-chloro-N-[(2R)-1,1,1-trifluoro-3-methylbutan-2-yl]benzo[c][1,6]naphthyridin-6-amine (PubChem CID 59375530) has the molecular formula C17H14BrClF3N3 and a molecular weight of 432.67 g/mol. Its IUPAC name is 9-bromo-1-chloro-N-[(2R)-1,1,1-trifluoro-3-methylbutan-2-yl]benzo[c][1,6]naphthyridin-6-amine.
| Compound Name | 9-bromo-1-chloro-N-[(2R)-1,1,1-trifluoro-3-methylbutan-2-yl]benzo[c][1,6]naphthyridin-6-amine |
|---|---|
| PubChem CID | 59375530 |
| Molecular Formula | C17H14BrClF3N3 |
| Molecular Weight | 432.67 g/mol |
| Exact Mass | 431.00 |
| IUPAC Name | 9-bromo-1-chloro-N-[(2R)-1,1,1-trifluoro-3-methylbutan-2-yl]benzo[c][1,6]naphthyridin-6-amine |
| SMILES | CC(C)[C@@H](Nc1nc2ccnc(Cl)c2c2cc(Br)ccc12)C(F)(F)F |
| InChI | InChI=1S/C17H14BrClF3N3/c1-8(2)14(17(20,21)22)25-16-10-4-3-9(18)7-11(10)13-12(24-16)5-6-23-15(13)19/h3-8,14H,1-2H3,(H,24,25)/t14-/m1/s1 |
| InChIKey | RGKSBMKLVLFXPD-CQSZACIVSA-N |
| XLogP | 6.20 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.67 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|