C27H26BrN3O — CID 59375663
9-bromo-6-(3,3-dimethylbutan-2-ylamino)-4-[2-(2-methylphenyl)ethynyl]-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 59375663) has the molecular formula C27H26BrN3O and a molecular weight of 488.43 g/mol. Its IUPAC name is 9-bromo-6-(3,3-dimethylbutan-2-ylamino)-4-[2-(2-methylphenyl)ethynyl]-2H-benzo[c][1,6]naphthyridin-1-one.
| Compound Name | 9-bromo-6-(3,3-dimethylbutan-2-ylamino)-4-[2-(2-methylphenyl)ethynyl]-2H-benzo[c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 59375663 |
| Molecular Formula | C27H26BrN3O |
| Molecular Weight | 488.43 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | 9-bromo-6-(3,3-dimethylbutan-2-ylamino)-4-[2-(2-methylphenyl)ethynyl]-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | Cc1ccccc1C#Cc1c[nH]c(=O)c2c1nc(NC(C)C(C)(C)C)c1ccc(Br)cc12 |
| InChI | InChI=1S/C27H26BrN3O/c1-16-8-6-7-9-18(16)10-11-19-15-29-26(32)23-22-14-20(28)12-13-21(22)25(31-24(19)23)30-17(2)27(3,4)5/h6-9,12-15,17H,1-5H3,(H,29,32)(H,30,31) |
| InChIKey | UAEOXXCUGSJRNG-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.43 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|