C20H22BrN3O2 — CID 59375691
4-acetyl-9-bromo-6-(3,3-dimethylbutan-2-ylamino)-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 59375691) has the molecular formula C20H22BrN3O2 and a molecular weight of 416.32 g/mol. Its IUPAC name is 4-acetyl-9-bromo-6-(3,3-dimethylbutan-2-ylamino)-2H-benzo[c][1,6]naphthyridin-1-one.
| Compound Name | 4-acetyl-9-bromo-6-(3,3-dimethylbutan-2-ylamino)-2H-benzo[c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 59375691 |
| Molecular Formula | C20H22BrN3O2 |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 4-acetyl-9-bromo-6-(3,3-dimethylbutan-2-ylamino)-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | CC(=O)c1c[nH]c(=O)c2c1nc(NC(C)C(C)(C)C)c1ccc(Br)cc12 |
| InChI | InChI=1S/C20H22BrN3O2/c1-10(25)15-9-22-19(26)16-14-8-12(21)6-7-13(14)18(24-17(15)16)23-11(2)20(3,4)5/h6-9,11H,1-5H3,(H,22,26)(H,23,24) |
| InChIKey | BPLKOXWRFCALPU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|