C20H20FN3O3 — CID 59375998
(7Z)-7-(5-fluoro-2-oxo-1H-indol-3-ylidene)-N-(2-hydroxyethyl)-2-methyl-1,4,5,6-tetrahydroindole-3-carboxamide (PubChem CID 59375998) has the molecular formula C20H20FN3O3 and a molecular weight of 369.40 g/mol. Its IUPAC name is (7Z)-7-(5-fluoro-2-oxo-1H-indol-3-ylidene)-N-(2-hydroxyethyl)-2-methyl-1,4,5,6-tetrahydroindole-3-carboxamide.
| Compound Name | (7Z)-7-(5-fluoro-2-oxo-1H-indol-3-ylidene)-N-(2-hydroxyethyl)-2-methyl-1,4,5,6-tetrahydroindole-3-carboxamide |
|---|---|
| PubChem CID | 59375998 |
| Molecular Formula | C20H20FN3O3 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (7Z)-7-(5-fluoro-2-oxo-1H-indol-3-ylidene)-N-(2-hydroxyethyl)-2-methyl-1,4,5,6-tetrahydroindole-3-carboxamide |
| SMILES | Cc1[nH]c2c(c1C(=O)NCCO)CCC/C2=C1/C(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C20H20FN3O3/c1-10-16(19(26)22-7-8-25)12-3-2-4-13(18(12)23-10)17-14-9-11(21)5-6-15(14)24-20(17)27/h5-6,9,23,25H,2-4,7-8H2,1H3,(H,22,26)(H,24,27)/b17-13- |
| InChIKey | GWQQUSRBNJRKLG-LGMDPLHJSA-N |
| XLogP | 2.38 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|