C24H29BrN4O2 — CID 59376009
(7Z)-7-(5-bromo-2-oxo-1H-indol-3-ylidene)-N-[2-(diethylamino)ethyl]-2-methyl-1,4,5,6-tetrahydroindole-3-carboxamide (PubChem CID 59376009) has the molecular formula C24H29BrN4O2 and a molecular weight of 485.43 g/mol. Its IUPAC name is (7Z)-7-(5-bromo-2-oxo-1H-indol-3-ylidene)-N-[2-(diethylamino)ethyl]-2-methyl-1,4,5,6-tetrahydroindole-3-carboxamide.
| Compound Name | (7Z)-7-(5-bromo-2-oxo-1H-indol-3-ylidene)-N-[2-(diethylamino)ethyl]-2-methyl-1,4,5,6-tetrahydroindole-3-carboxamide |
|---|---|
| PubChem CID | 59376009 |
| Molecular Formula | C24H29BrN4O2 |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | (7Z)-7-(5-bromo-2-oxo-1H-indol-3-ylidene)-N-[2-(diethylamino)ethyl]-2-methyl-1,4,5,6-tetrahydroindole-3-carboxamide |
| SMILES | CCN(CC)CCNC(=O)c1c(C)[nH]c2c1CCC/C2=C1/C(=O)Nc2ccc(Br)cc21 |
| InChI | InChI=1S/C24H29BrN4O2/c1-4-29(5-2)12-11-26-23(30)20-14(3)27-22-16(20)7-6-8-17(22)21-18-13-15(25)9-10-19(18)28-24(21)31/h9-10,13,27H,4-8,11-12H2,1-3H3,(H,26,30)(H,28,31)/b21-17- |
| InChIKey | NXQOLSZAEQSUKO-FXBPSFAMSA-N |
| XLogP | 4.36 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|