C25H29FN4O3 — CID 59376058
(7Z)-7-(5-fluoro-2-oxo-1H-indol-3-ylidene)-2-methyl-N-(3-morpholin-4-ylpropyl)-1,4,5,6-tetrahydroindole-3-carboxamide (PubChem CID 59376058) has the molecular formula C25H29FN4O3 and a molecular weight of 452.53 g/mol. Its IUPAC name is (7Z)-7-(5-fluoro-2-oxo-1H-indol-3-ylidene)-2-methyl-N-(3-morpholin-4-ylpropyl)-1,4,5,6-tetrahydroindole-3-carboxamide.
| Compound Name | (7Z)-7-(5-fluoro-2-oxo-1H-indol-3-ylidene)-2-methyl-N-(3-morpholin-4-ylpropyl)-1,4,5,6-tetrahydroindole-3-carboxamide |
|---|---|
| PubChem CID | 59376058 |
| Molecular Formula | C25H29FN4O3 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | (7Z)-7-(5-fluoro-2-oxo-1H-indol-3-ylidene)-2-methyl-N-(3-morpholin-4-ylpropyl)-1,4,5,6-tetrahydroindole-3-carboxamide |
| SMILES | Cc1[nH]c2c(c1C(=O)NCCCN1CCOCC1)CCC/C2=C1/C(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C25H29FN4O3/c1-15-21(24(31)27-8-3-9-30-10-12-33-13-11-30)17-4-2-5-18(23(17)28-15)22-19-14-16(26)6-7-20(19)29-25(22)32/h6-7,14,28H,2-5,8-13H2,1H3,(H,27,31)(H,29,32)/b22-18- |
| InChIKey | MWDKQVZICDCEDA-PYCFMQQDSA-N |
| XLogP | 3.11 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|