C26H32N4O3 — CID 59376071
(7Z)-2-methyl-7-(5-methyl-2-oxo-1H-indol-3-ylidene)-N-(3-morpholin-4-ylpropyl)-1,4,5,6-tetrahydroindole-3-carboxamide (PubChem CID 59376071) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is (7Z)-2-methyl-7-(5-methyl-2-oxo-1H-indol-3-ylidene)-N-(3-morpholin-4-ylpropyl)-1,4,5,6-tetrahydroindole-3-carboxamide.
| Compound Name | (7Z)-2-methyl-7-(5-methyl-2-oxo-1H-indol-3-ylidene)-N-(3-morpholin-4-ylpropyl)-1,4,5,6-tetrahydroindole-3-carboxamide |
|---|---|
| PubChem CID | 59376071 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | (7Z)-2-methyl-7-(5-methyl-2-oxo-1H-indol-3-ylidene)-N-(3-morpholin-4-ylpropyl)-1,4,5,6-tetrahydroindole-3-carboxamide |
| SMILES | Cc1ccc2c(c1)/C(=C1\CCCc3c1[nH]c(C)c3C(=O)NCCCN1CCOCC1)C(=O)N2 |
| InChI | InChI=1S/C26H32N4O3/c1-16-7-8-21-20(15-16)23(26(32)29-21)19-6-3-5-18-22(17(2)28-24(18)19)25(31)27-9-4-10-30-11-13-33-14-12-30/h7-8,15,28H,3-6,9-14H2,1-2H3,(H,27,31)(H,29,32)/b23-19- |
| InChIKey | BZYBQEMSZUFQFC-NMWGTECJSA-N |
| XLogP | 3.28 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|