C25H23FN4O2 — CID 59376082
(7Z)-7-(5-fluoro-2-oxo-1H-indol-3-ylidene)-2-methyl-N-(2-pyridin-2-ylethyl)-1,4,5,6-tetrahydroindole-3-carboxamide (PubChem CID 59376082) has the molecular formula C25H23FN4O2 and a molecular weight of 430.48 g/mol. Its IUPAC name is (7Z)-7-(5-fluoro-2-oxo-1H-indol-3-ylidene)-2-methyl-N-(2-pyridin-2-ylethyl)-1,4,5,6-tetrahydroindole-3-carboxamide.
| Compound Name | (7Z)-7-(5-fluoro-2-oxo-1H-indol-3-ylidene)-2-methyl-N-(2-pyridin-2-ylethyl)-1,4,5,6-tetrahydroindole-3-carboxamide |
|---|---|
| PubChem CID | 59376082 |
| Molecular Formula | C25H23FN4O2 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | (7Z)-7-(5-fluoro-2-oxo-1H-indol-3-ylidene)-2-methyl-N-(2-pyridin-2-ylethyl)-1,4,5,6-tetrahydroindole-3-carboxamide |
| SMILES | Cc1[nH]c2c(c1C(=O)NCCc1ccccn1)CCC/C2=C1/C(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C25H23FN4O2/c1-14-21(24(31)28-12-10-16-5-2-3-11-27-16)17-6-4-7-18(23(17)29-14)22-19-13-15(26)8-9-20(19)30-25(22)32/h2-3,5,8-9,11,13,29H,4,6-7,10,12H2,1H3,(H,28,31)(H,30,32)/b22-18- |
| InChIKey | OIXCGPYMAZCOHK-PYCFMQQDSA-N |
| XLogP | 4.03 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|