About 1-[2-(3-hydroxypropyl)-1,3-dithian-2-yl]pentan-3-ol
1-[2-(3-hydroxypropyl)-1,3-dithian-2-yl]pentan-3-ol (PubChem CID 593763) has the molecular formula C12H24O2S2
and a molecular weight of 264.46 g/mol. Its IUPAC name is 1-[2-(3-hydroxypropyl)-1,3-dithian-2-yl]pentan-3-ol.
Molecular Properties
| Compound Name | 1-[2-(3-hydroxypropyl)-1,3-dithian-2-yl]pentan-3-ol |
| PubChem CID | 593763 |
| Molecular Formula | C12H24O2S2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1-[2-(3-hydroxypropyl)-1,3-dithian-2-yl]pentan-3-ol |
| SMILES | CCC(O)CCC1(CCCO)SCCCS1 |
| InChI | InChI=1S/C12H24O2S2/c1-2-11(14)5-7-12(6-3-8-13)15-9-4-10-16-12/h11,13-14H,2-10H2,1H3 |
| InChIKey | FWNIIKDZZATSSB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(3-hydroxypropyl)-1,3-dithian-2-yl]pentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3-hydroxypropyl)-1,3-dithian-2-yl]pentan-3-ol?
The IUPAC name of 1-[2-(3-hydroxypropyl)-1,3-dithian-2-yl]pentan-3-ol (CID 593763) is 1-[2-(3-hydroxypropyl)-1,3-dithian-2-yl]pentan-3-ol.
What is the SMILES notation for 1-[2-(3-hydroxypropyl)-1,3-dithian-2-yl]pentan-3-ol?
The canonical SMILES for 1-[2-(3-hydroxypropyl)-1,3-dithian-2-yl]pentan-3-ol is CCC(O)CCC1(CCCO)SCCCS1.
What is the InChIKey of 1-[2-(3-hydroxypropyl)-1,3-dithian-2-yl]pentan-3-ol?
The InChIKey is FWNIIKDZZATSSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2S2/c1-2-11(14)5-7-12(6-3-8-13)15-9-4-10-16-12/h11,13-14H,2-10H2,1H3.
What are the key properties of 1-[2-(3-hydroxypropyl)-1,3-dithian-2-yl]pentan-3-ol?
1-[2-(3-hydroxypropyl)-1,3-dithian-2-yl]pentan-3-ol has a molecular weight of 264.46 g/mol, XLogP of 2.88, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3-hydroxypropyl)-1,3-dithian-2-yl]pentan-3-ol is sourced from PubChem (CID 593763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).