About CID 59376402
CID 59376402 (PubChem CID 59376402) has the molecular formula C11H9Cl2NO
and a molecular weight of 242.10 g/mol.
Molecular Properties
| Compound Name | CID 59376402 |
| PubChem CID | 59376402 |
| Molecular Formula | C11H9Cl2NO |
| Molecular Weight | 242.10 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | — |
| SMILES | [CH]CC1CC(c2c(Cl)cccc2Cl)=NO1 |
| InChI | InChI=1S/C11H9Cl2NO/c1-2-7-6-10(14-15-7)11-8(12)4-3-5-9(11)13/h1,3-5,7H,2,6H2 |
| InChIKey | FDJWPCPKQHWVFE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.10 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 59376402 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59376402?
The IUPAC name of CID 59376402 (CID 59376402) is not available.
What is the SMILES notation for CID 59376402?
The canonical SMILES for CID 59376402 is [CH]CC1CC(c2c(Cl)cccc2Cl)=NO1.
What is the InChIKey of CID 59376402?
The InChIKey is FDJWPCPKQHWVFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Cl2NO/c1-2-7-6-10(14-15-7)11-8(12)4-3-5-9(11)13/h1,3-5,7H,2,6H2.
What are the key properties of CID 59376402?
CID 59376402 has a molecular weight of 242.10 g/mol, XLogP of 3.59, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59376402 is sourced from PubChem (CID 59376402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).