About N-[4-[[4-(2,3-dihydroazet-4-ylamino)phenyl]methyl]phenyl]-2,3-dihydroazet-4-amine
N-[4-[[4-(2,3-dihydroazet-4-ylamino)phenyl]methyl]phenyl]-2,3-dihydroazet-4-amine (PubChem CID 59376476) has the molecular formula C19H20N4
and a molecular weight of 304.40 g/mol. Its IUPAC name is N-[4-[[4-(2,3-dihydroazet-4-ylamino)phenyl]methyl]phenyl]-2,3-dihydroazet-4-amine.
Molecular Properties
| Compound Name | N-[4-[[4-(2,3-dihydroazet-4-ylamino)phenyl]methyl]phenyl]-2,3-dihydroazet-4-amine |
| PubChem CID | 59376476 |
| Molecular Formula | C19H20N4 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | N-[4-[[4-(2,3-dihydroazet-4-ylamino)phenyl]methyl]phenyl]-2,3-dihydroazet-4-amine |
| SMILES | c1cc(NC2=NCC2)ccc1Cc1ccc(NC2=NCC2)cc1 |
| InChI | InChI=1S/C19H20N4/c1-5-16(22-18-9-11-20-18)6-2-14(1)13-15-3-7-17(8-4-15)23-19-10-12-21-19/h1-8H,9-13H2,(H,20,22)(H,21,23) |
| InChIKey | YRRHISXNVMFHLV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-[[4-(2,3-dihydroazet-4-ylamino)phenyl]methyl]phenyl]-2,3-dihydroazet-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[[4-(2,3-dihydroazet-4-ylamino)phenyl]methyl]phenyl]-2,3-dihydroazet-4-amine?
The IUPAC name of N-[4-[[4-(2,3-dihydroazet-4-ylamino)phenyl]methyl]phenyl]-2,3-dihydroazet-4-amine (CID 59376476) is N-[4-[[4-(2,3-dihydroazet-4-ylamino)phenyl]methyl]phenyl]-2,3-dihydroazet-4-amine.
What is the SMILES notation for N-[4-[[4-(2,3-dihydroazet-4-ylamino)phenyl]methyl]phenyl]-2,3-dihydroazet-4-amine?
The canonical SMILES for N-[4-[[4-(2,3-dihydroazet-4-ylamino)phenyl]methyl]phenyl]-2,3-dihydroazet-4-amine is c1cc(NC2=NCC2)ccc1Cc1ccc(NC2=NCC2)cc1.
What is the InChIKey of N-[4-[[4-(2,3-dihydroazet-4-ylamino)phenyl]methyl]phenyl]-2,3-dihydroazet-4-amine?
The InChIKey is YRRHISXNVMFHLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4/c1-5-16(22-18-9-11-20-18)6-2-14(1)13-15-3-7-17(8-4-15)23-19-10-12-21-19/h1-8H,9-13H2,(H,20,22)(H,21,23).
What are the key properties of N-[4-[[4-(2,3-dihydroazet-4-ylamino)phenyl]methyl]phenyl]-2,3-dihydroazet-4-amine?
N-[4-[[4-(2,3-dihydroazet-4-ylamino)phenyl]methyl]phenyl]-2,3-dihydroazet-4-amine has a molecular weight of 304.40 g/mol, XLogP of 3.71, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[[4-(2,3-dihydroazet-4-ylamino)phenyl]methyl]phenyl]-2,3-dihydroazet-4-amine is sourced from PubChem (CID 59376476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).