C21H24BrN3O2 — CID 59376512
2-(4-bromobutyl)-6-(8-methoxy-2-propan-2-ylquinolin-5-yl)pyridazin-3-one (PubChem CID 59376512) has the molecular formula C21H24BrN3O2 and a molecular weight of 430.35 g/mol. Its IUPAC name is 2-(4-bromobutyl)-6-(8-methoxy-2-propan-2-ylquinolin-5-yl)pyridazin-3-one.
| Compound Name | 2-(4-bromobutyl)-6-(8-methoxy-2-propan-2-ylquinolin-5-yl)pyridazin-3-one |
|---|---|
| PubChem CID | 59376512 |
| Molecular Formula | C21H24BrN3O2 |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 2-(4-bromobutyl)-6-(8-methoxy-2-propan-2-ylquinolin-5-yl)pyridazin-3-one |
| SMILES | COc1ccc(-c2ccc(=O)n(CCCCBr)n2)c2ccc(C(C)C)nc12 |
| InChI | InChI=1S/C21H24BrN3O2/c1-14(2)17-8-6-16-15(7-10-19(27-3)21(16)23-17)18-9-11-20(26)25(24-18)13-5-4-12-22/h6-11,14H,4-5,12-13H2,1-3H3 |
| InChIKey | UYHFVQBMLCVMLW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|