About (1R)-7-methoxy-1-methyl-1,2,3,4-tetrahydronaphthalene
(1R)-7-methoxy-1-methyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 59377464) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is (1R)-7-methoxy-1-methyl-1,2,3,4-tetrahydronaphthalene.
Molecular Properties
| Compound Name | (1R)-7-methoxy-1-methyl-1,2,3,4-tetrahydronaphthalene |
| PubChem CID | 59377464 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | (1R)-7-methoxy-1-methyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | COc1ccc2c(c1)[C@H](C)CCC2 |
| InChI | InChI=1S/C12H16O/c1-9-4-3-5-10-6-7-11(13-2)8-12(9)10/h6-9H,3-5H2,1-2H3/t9-/m1/s1 |
| InChIKey | KSWPMXHTZCMXBJ-SECBINFHSA-N |
| XLogP | 3.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R)-7-methoxy-1-methyl-1,2,3,4-tetrahydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-7-methoxy-1-methyl-1,2,3,4-tetrahydronaphthalene?
The IUPAC name of (1R)-7-methoxy-1-methyl-1,2,3,4-tetrahydronaphthalene (CID 59377464) is (1R)-7-methoxy-1-methyl-1,2,3,4-tetrahydronaphthalene.
What is the SMILES notation for (1R)-7-methoxy-1-methyl-1,2,3,4-tetrahydronaphthalene?
The canonical SMILES for (1R)-7-methoxy-1-methyl-1,2,3,4-tetrahydronaphthalene is COc1ccc2c(c1)[C@H](C)CCC2.
What is the InChIKey of (1R)-7-methoxy-1-methyl-1,2,3,4-tetrahydronaphthalene?
The InChIKey is KSWPMXHTZCMXBJ-SECBINFHSA-N. The full InChI is InChI=1S/C12H16O/c1-9-4-3-5-10-6-7-11(13-2)8-12(9)10/h6-9H,3-5H2,1-2H3/t9-/m1/s1.
What are the key properties of (1R)-7-methoxy-1-methyl-1,2,3,4-tetrahydronaphthalene?
(1R)-7-methoxy-1-methyl-1,2,3,4-tetrahydronaphthalene has a molecular weight of 176.26 g/mol, XLogP of 3.13, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-7-methoxy-1-methyl-1,2,3,4-tetrahydronaphthalene is sourced from PubChem (CID 59377464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).