C15H29F3 — CID 59378145
(3S)-2,2,3,8,8-pentamethyl-3-(trifluoromethyl)nonane (PubChem CID 59378145) has the molecular formula C15H29F3 and a molecular weight of 266.39 g/mol. Its IUPAC name is (3S)-2,2,3,8,8-pentamethyl-3-(trifluoromethyl)nonane.
| Compound Name | (3S)-2,2,3,8,8-pentamethyl-3-(trifluoromethyl)nonane |
|---|---|
| PubChem CID | 59378145 |
| Molecular Formula | C15H29F3 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | (3S)-2,2,3,8,8-pentamethyl-3-(trifluoromethyl)nonane |
| SMILES | CC(C)(C)CCCC[C@@](C)(C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C15H29F3/c1-12(2,3)10-8-9-11-14(7,13(4,5)6)15(16,17)18/h8-11H2,1-7H3/t14-/m0/s1 |
| InChIKey | JHTYUFKVPSBJCT-AWEZNQCLSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|