About methyl 2-(4-oxocyclohexyl)-2-(3,3,3-trifluoropropylsulfonyl)acetate
methyl 2-(4-oxocyclohexyl)-2-(3,3,3-trifluoropropylsulfonyl)acetate (PubChem CID 59378263) has the molecular formula C12H17F3O5S
and a molecular weight of 330.32 g/mol. Its IUPAC name is methyl 2-(4-oxocyclohexyl)-2-(3,3,3-trifluoropropylsulfonyl)acetate.
Molecular Properties
| Compound Name | methyl 2-(4-oxocyclohexyl)-2-(3,3,3-trifluoropropylsulfonyl)acetate |
| PubChem CID | 59378263 |
| Molecular Formula | C12H17F3O5S |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | methyl 2-(4-oxocyclohexyl)-2-(3,3,3-trifluoropropylsulfonyl)acetate |
| SMILES | COC(=O)C(C1CCC(=O)CC1)S(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C12H17F3O5S/c1-20-11(17)10(8-2-4-9(16)5-3-8)21(18,19)7-6-12(13,14)15/h8,10H,2-7H2,1H3 |
| InChIKey | XRLOASQRYODZQD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-(4-oxocyclohexyl)-2-(3,3,3-trifluoropropylsulfonyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(4-oxocyclohexyl)-2-(3,3,3-trifluoropropylsulfonyl)acetate?
The IUPAC name of methyl 2-(4-oxocyclohexyl)-2-(3,3,3-trifluoropropylsulfonyl)acetate (CID 59378263) is methyl 2-(4-oxocyclohexyl)-2-(3,3,3-trifluoropropylsulfonyl)acetate.
What is the SMILES notation for methyl 2-(4-oxocyclohexyl)-2-(3,3,3-trifluoropropylsulfonyl)acetate?
The canonical SMILES for methyl 2-(4-oxocyclohexyl)-2-(3,3,3-trifluoropropylsulfonyl)acetate is COC(=O)C(C1CCC(=O)CC1)S(=O)(=O)CCC(F)(F)F.
What is the InChIKey of methyl 2-(4-oxocyclohexyl)-2-(3,3,3-trifluoropropylsulfonyl)acetate?
The InChIKey is XRLOASQRYODZQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F3O5S/c1-20-11(17)10(8-2-4-9(16)5-3-8)21(18,19)7-6-12(13,14)15/h8,10H,2-7H2,1H3.
What are the key properties of methyl 2-(4-oxocyclohexyl)-2-(3,3,3-trifluoropropylsulfonyl)acetate?
methyl 2-(4-oxocyclohexyl)-2-(3,3,3-trifluoropropylsulfonyl)acetate has a molecular weight of 330.32 g/mol, XLogP of 1.65, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-oxocyclohexyl)-2-(3,3,3-trifluoropropylsulfonyl)acetate is sourced from PubChem (CID 59378263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).