About 1-methylidene-4-(3,3,3-trifluoropropylsulfonylmethyl)cyclohexane
1-methylidene-4-(3,3,3-trifluoropropylsulfonylmethyl)cyclohexane (PubChem CID 59378265) has the molecular formula C11H17F3O2S
and a molecular weight of 270.32 g/mol. Its IUPAC name is 1-methylidene-4-(3,3,3-trifluoropropylsulfonylmethyl)cyclohexane.
Molecular Properties
| Compound Name | 1-methylidene-4-(3,3,3-trifluoropropylsulfonylmethyl)cyclohexane |
| PubChem CID | 59378265 |
| Molecular Formula | C11H17F3O2S |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 1-methylidene-4-(3,3,3-trifluoropropylsulfonylmethyl)cyclohexane |
| SMILES | C=C1CCC(CS(=O)(=O)CCC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H17F3O2S/c1-9-2-4-10(5-3-9)8-17(15,16)7-6-11(12,13)14/h10H,1-8H2 |
| InChIKey | IWGONFUMKDFZCH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methylidene-4-(3,3,3-trifluoropropylsulfonylmethyl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylidene-4-(3,3,3-trifluoropropylsulfonylmethyl)cyclohexane?
The IUPAC name of 1-methylidene-4-(3,3,3-trifluoropropylsulfonylmethyl)cyclohexane (CID 59378265) is 1-methylidene-4-(3,3,3-trifluoropropylsulfonylmethyl)cyclohexane.
What is the SMILES notation for 1-methylidene-4-(3,3,3-trifluoropropylsulfonylmethyl)cyclohexane?
The canonical SMILES for 1-methylidene-4-(3,3,3-trifluoropropylsulfonylmethyl)cyclohexane is C=C1CCC(CS(=O)(=O)CCC(F)(F)F)CC1.
What is the InChIKey of 1-methylidene-4-(3,3,3-trifluoropropylsulfonylmethyl)cyclohexane?
The InChIKey is IWGONFUMKDFZCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F3O2S/c1-9-2-4-10(5-3-9)8-17(15,16)7-6-11(12,13)14/h10H,1-8H2.
What are the key properties of 1-methylidene-4-(3,3,3-trifluoropropylsulfonylmethyl)cyclohexane?
1-methylidene-4-(3,3,3-trifluoropropylsulfonylmethyl)cyclohexane has a molecular weight of 270.32 g/mol, XLogP of 3.10, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylidene-4-(3,3,3-trifluoropropylsulfonylmethyl)cyclohexane is sourced from PubChem (CID 59378265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).