C13H15F4NS — CID 59378302
2-(4-ethynyl-4-fluorocyclohexyl)-2-(3,3,3-trifluoropropylsulfanyl)acetonitrile (PubChem CID 59378302) has the molecular formula C13H15F4NS and a molecular weight of 293.33 g/mol. Its IUPAC name is 2-(4-ethynyl-4-fluorocyclohexyl)-2-(3,3,3-trifluoropropylsulfanyl)acetonitrile.
| Compound Name | 2-(4-ethynyl-4-fluorocyclohexyl)-2-(3,3,3-trifluoropropylsulfanyl)acetonitrile |
|---|---|
| PubChem CID | 59378302 |
| Molecular Formula | C13H15F4NS |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2-(4-ethynyl-4-fluorocyclohexyl)-2-(3,3,3-trifluoropropylsulfanyl)acetonitrile |
| SMILES | C#CC1(F)CCC(C(C#N)SCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H15F4NS/c1-2-12(14)5-3-10(4-6-12)11(9-18)19-8-7-13(15,16)17/h1,10-11H,3-8H2 |
| InChIKey | JDXQKPIWIITVJM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|