About 1-ethynyl-4-(3,3,3-trifluoropropylsulfinylmethyl)cyclohexane
1-ethynyl-4-(3,3,3-trifluoropropylsulfinylmethyl)cyclohexane (PubChem CID 59378313) has the molecular formula C12H17F3OS
and a molecular weight of 266.33 g/mol. Its IUPAC name is 1-ethynyl-4-(3,3,3-trifluoropropylsulfinylmethyl)cyclohexane.
Molecular Properties
| Compound Name | 1-ethynyl-4-(3,3,3-trifluoropropylsulfinylmethyl)cyclohexane |
| PubChem CID | 59378313 |
| Molecular Formula | C12H17F3OS |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 1-ethynyl-4-(3,3,3-trifluoropropylsulfinylmethyl)cyclohexane |
| SMILES | C#CC1CCC(CS(=O)CCC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H17F3OS/c1-2-10-3-5-11(6-4-10)9-17(16)8-7-12(13,14)15/h1,10-11H,3-9H2 |
| InChIKey | CJIUUAHMHNRZEC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethynyl-4-(3,3,3-trifluoropropylsulfinylmethyl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethynyl-4-(3,3,3-trifluoropropylsulfinylmethyl)cyclohexane?
The IUPAC name of 1-ethynyl-4-(3,3,3-trifluoropropylsulfinylmethyl)cyclohexane (CID 59378313) is 1-ethynyl-4-(3,3,3-trifluoropropylsulfinylmethyl)cyclohexane.
What is the SMILES notation for 1-ethynyl-4-(3,3,3-trifluoropropylsulfinylmethyl)cyclohexane?
The canonical SMILES for 1-ethynyl-4-(3,3,3-trifluoropropylsulfinylmethyl)cyclohexane is C#CC1CCC(CS(=O)CCC(F)(F)F)CC1.
What is the InChIKey of 1-ethynyl-4-(3,3,3-trifluoropropylsulfinylmethyl)cyclohexane?
The InChIKey is CJIUUAHMHNRZEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F3OS/c1-2-10-3-5-11(6-4-10)9-17(16)8-7-12(13,14)15/h1,10-11H,3-9H2.
What are the key properties of 1-ethynyl-4-(3,3,3-trifluoropropylsulfinylmethyl)cyclohexane?
1-ethynyl-4-(3,3,3-trifluoropropylsulfinylmethyl)cyclohexane has a molecular weight of 266.33 g/mol, XLogP of 3.13, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethynyl-4-(3,3,3-trifluoropropylsulfinylmethyl)cyclohexane is sourced from PubChem (CID 59378313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).