About benzene;N-(2-oxocyclopentyl)butanamide;yttrium
benzene;N-(2-oxocyclopentyl)butanamide;yttrium (PubChem CID 59378329) has the molecular formula C15H19NO2Y-2
and a molecular weight of 334.23 g/mol. Its IUPAC name is benzene;N-(2-oxocyclopentyl)butanamide;yttrium.
Molecular Properties
| Compound Name | benzene;N-(2-oxocyclopentyl)butanamide;yttrium |
| PubChem CID | 59378329 |
| Molecular Formula | C15H19NO2Y-2 |
| Molecular Weight | 334.23 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | benzene;N-(2-oxocyclopentyl)butanamide;yttrium |
| SMILES | [CH2-]CCC(=O)NC1CCCC1=O.[Y].[c-]1ccccc1 |
| InChI | InChI=1S/C9H14NO2.C6H5.Y/c1-2-4-9(12)10-7-5-3-6-8(7)11;1-2-4-6-5-3-1;/h7H,1-6H2,(H,10,12);1-5H;/q2*-1; |
| InChIKey | XTHBTRGMBPXVEQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze benzene;N-(2-oxocyclopentyl)butanamide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;N-(2-oxocyclopentyl)butanamide;yttrium?
The IUPAC name of benzene;N-(2-oxocyclopentyl)butanamide;yttrium (CID 59378329) is benzene;N-(2-oxocyclopentyl)butanamide;yttrium.
What is the SMILES notation for benzene;N-(2-oxocyclopentyl)butanamide;yttrium?
The canonical SMILES for benzene;N-(2-oxocyclopentyl)butanamide;yttrium is [CH2-]CCC(=O)NC1CCCC1=O.[Y].[c-]1ccccc1.
What is the InChIKey of benzene;N-(2-oxocyclopentyl)butanamide;yttrium?
The InChIKey is XTHBTRGMBPXVEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14NO2.C6H5.Y/c1-2-4-9(12)10-7-5-3-6-8(7)11;1-2-4-6-5-3-1;/h7H,1-6H2,(H,10,12);1-5H;/q2*-1;.
What are the key properties of benzene;N-(2-oxocyclopentyl)butanamide;yttrium?
benzene;N-(2-oxocyclopentyl)butanamide;yttrium has a molecular weight of 334.23 g/mol, XLogP of 2.32, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;N-(2-oxocyclopentyl)butanamide;yttrium is sourced from PubChem (CID 59378329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).