About 2-fluoro-2-(3,3,3-trifluoropropylsulfanyl)oct-7-ynamide
2-fluoro-2-(3,3,3-trifluoropropylsulfanyl)oct-7-ynamide (PubChem CID 59378481) has the molecular formula C11H15F4NOS
and a molecular weight of 285.31 g/mol. Its IUPAC name is 2-fluoro-2-(3,3,3-trifluoropropylsulfanyl)oct-7-ynamide.
Molecular Properties
| Compound Name | 2-fluoro-2-(3,3,3-trifluoropropylsulfanyl)oct-7-ynamide |
| PubChem CID | 59378481 |
| Molecular Formula | C11H15F4NOS |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-fluoro-2-(3,3,3-trifluoropropylsulfanyl)oct-7-ynamide |
| SMILES | C#CCCCCC(F)(SCCC(F)(F)F)C(N)=O |
| InChI | InChI=1S/C11H15F4NOS/c1-2-3-4-5-6-10(12,9(16)17)18-8-7-11(13,14)15/h1H,3-8H2,(H2,16,17) |
| InChIKey | ZVFFXBYBWDMCBT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-2-(3,3,3-trifluoropropylsulfanyl)oct-7-ynamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-2-(3,3,3-trifluoropropylsulfanyl)oct-7-ynamide?
The IUPAC name of 2-fluoro-2-(3,3,3-trifluoropropylsulfanyl)oct-7-ynamide (CID 59378481) is 2-fluoro-2-(3,3,3-trifluoropropylsulfanyl)oct-7-ynamide.
What is the SMILES notation for 2-fluoro-2-(3,3,3-trifluoropropylsulfanyl)oct-7-ynamide?
The canonical SMILES for 2-fluoro-2-(3,3,3-trifluoropropylsulfanyl)oct-7-ynamide is C#CCCCCC(F)(SCCC(F)(F)F)C(N)=O.
What is the InChIKey of 2-fluoro-2-(3,3,3-trifluoropropylsulfanyl)oct-7-ynamide?
The InChIKey is ZVFFXBYBWDMCBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F4NOS/c1-2-3-4-5-6-10(12,9(16)17)18-8-7-11(13,14)15/h1H,3-8H2,(H2,16,17).
What are the key properties of 2-fluoro-2-(3,3,3-trifluoropropylsulfanyl)oct-7-ynamide?
2-fluoro-2-(3,3,3-trifluoropropylsulfanyl)oct-7-ynamide has a molecular weight of 285.31 g/mol, XLogP of 3.02, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-2-(3,3,3-trifluoropropylsulfanyl)oct-7-ynamide is sourced from PubChem (CID 59378481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).