C22H15F4O3S+ — CID 59379032
diphenyl-[2,3,5,6-tetrafluoro-4-(2-oxooxolan-3-yl)oxyphenyl]sulfanium (PubChem CID 59379032) has the molecular formula C22H15F4O3S+ and a molecular weight of 435.42 g/mol. Its IUPAC name is diphenyl-[2,3,5,6-tetrafluoro-4-(2-oxooxolan-3-yl)oxyphenyl]sulfanium.
| Compound Name | diphenyl-[2,3,5,6-tetrafluoro-4-(2-oxooxolan-3-yl)oxyphenyl]sulfanium |
|---|---|
| PubChem CID | 59379032 |
| Molecular Formula | C22H15F4O3S+ |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | diphenyl-[2,3,5,6-tetrafluoro-4-(2-oxooxolan-3-yl)oxyphenyl]sulfanium |
| SMILES | O=C1OCCC1Oc1c(F)c(F)c([S+](c2ccccc2)c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C22H15F4O3S/c23-16-18(25)21(19(26)17(24)20(16)29-15-11-12-28-22(15)27)30(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15H,11-12H2/q+1 |
| InChIKey | HEDCMKLUMROEKN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|