About 5,7,8-trimethyl-2-oxa-5-azabicyclo[4.2.0]octa-1(8),6-diene
5,7,8-trimethyl-2-oxa-5-azabicyclo[4.2.0]octa-1(8),6-diene (PubChem CID 59379131) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 5,7,8-trimethyl-2-oxa-5-azabicyclo[4.2.0]octa-1(8),6-diene.
Molecular Properties
| Compound Name | 5,7,8-trimethyl-2-oxa-5-azabicyclo[4.2.0]octa-1(8),6-diene |
| PubChem CID | 59379131 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 5,7,8-trimethyl-2-oxa-5-azabicyclo[4.2.0]octa-1(8),6-diene |
| SMILES | CC1=C2OCCN(C)C2=C1C |
| InChI | InChI=1S/C9H13NO/c1-6-7(2)9-8(6)10(3)4-5-11-9/h4-5H2,1-3H3 |
| InChIKey | GIZASULKLGESQY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,7,8-trimethyl-2-oxa-5-azabicyclo[4.2.0]octa-1(8),6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7,8-trimethyl-2-oxa-5-azabicyclo[4.2.0]octa-1(8),6-diene?
The IUPAC name of 5,7,8-trimethyl-2-oxa-5-azabicyclo[4.2.0]octa-1(8),6-diene (CID 59379131) is 5,7,8-trimethyl-2-oxa-5-azabicyclo[4.2.0]octa-1(8),6-diene.
What is the SMILES notation for 5,7,8-trimethyl-2-oxa-5-azabicyclo[4.2.0]octa-1(8),6-diene?
The canonical SMILES for 5,7,8-trimethyl-2-oxa-5-azabicyclo[4.2.0]octa-1(8),6-diene is CC1=C2OCCN(C)C2=C1C.
What is the InChIKey of 5,7,8-trimethyl-2-oxa-5-azabicyclo[4.2.0]octa-1(8),6-diene?
The InChIKey is GIZASULKLGESQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-6-7(2)9-8(6)10(3)4-5-11-9/h4-5H2,1-3H3.
What are the key properties of 5,7,8-trimethyl-2-oxa-5-azabicyclo[4.2.0]octa-1(8),6-diene?
5,7,8-trimethyl-2-oxa-5-azabicyclo[4.2.0]octa-1(8),6-diene has a molecular weight of 151.21 g/mol, XLogP of 1.51, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7,8-trimethyl-2-oxa-5-azabicyclo[4.2.0]octa-1(8),6-diene is sourced from PubChem (CID 59379131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).