About (4R,5S)-4,5-dimethyl-4,5-dihydro-1,3-thiazole
(4R,5S)-4,5-dimethyl-4,5-dihydro-1,3-thiazole (PubChem CID 59379152) has the molecular formula C5H9NS
and a molecular weight of 115.20 g/mol. Its IUPAC name is (4R,5S)-4,5-dimethyl-4,5-dihydro-1,3-thiazole.
Analyze (4R,5S)-4,5-dimethyl-4,5-dihydro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5S)-4,5-dimethyl-4,5-dihydro-1,3-thiazole?
The IUPAC name of (4R,5S)-4,5-dimethyl-4,5-dihydro-1,3-thiazole (CID 59379152) is (4R,5S)-4,5-dimethyl-4,5-dihydro-1,3-thiazole.
What is the SMILES notation for (4R,5S)-4,5-dimethyl-4,5-dihydro-1,3-thiazole?
The canonical SMILES for (4R,5S)-4,5-dimethyl-4,5-dihydro-1,3-thiazole is C[C@@H]1SC=N[C@@H]1C.
What is the InChIKey of (4R,5S)-4,5-dimethyl-4,5-dihydro-1,3-thiazole?
The InChIKey is MQULHHGPCRMEGA-UHNVWZDZSA-N. The full InChI is InChI=1S/C5H9NS/c1-4-5(2)7-3-6-4/h3-5H,1-2H3/t4-,5+/m1/s1.
What are the key properties of (4R,5S)-4,5-dimethyl-4,5-dihydro-1,3-thiazole?
(4R,5S)-4,5-dimethyl-4,5-dihydro-1,3-thiazole has a molecular weight of 115.20 g/mol, XLogP of 1.54, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5S)-4,5-dimethyl-4,5-dihydro-1,3-thiazole is sourced from PubChem (CID 59379152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).