C21H13F6NO2 — CID 59379246
(3S)-3-[3-(trifluoromethoxy)phenyl]-8-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 59379246) has the molecular formula C21H13F6NO2 and a molecular weight of 425.33 g/mol. Its IUPAC name is (3S)-3-[3-(trifluoromethoxy)phenyl]-8-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | (3S)-3-[3-(trifluoromethoxy)phenyl]-8-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 59379246 |
| Molecular Formula | C21H13F6NO2 |
| Molecular Weight | 425.33 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | (3S)-3-[3-(trifluoromethoxy)phenyl]-8-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | Fc1cc(-c2cccc3c2OC[C@H](c2cccc(OC(F)(F)F)c2)N3)cc(F)c1F |
| InChI | InChI=1S/C21H13F6NO2/c22-15-8-12(9-16(23)19(15)24)14-5-2-6-17-20(14)29-10-18(28-17)11-3-1-4-13(7-11)30-21(25,26)27/h1-9,18,28H,10H2/t18-/m1/s1 |
| InChIKey | WABMPPGHVDSIRW-GOSISDBHSA-N |
| XLogP | 6.22 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.33 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|