C23H23F3N4O3S — CID 59379993
4-[4-[(3S)-3-methylmorpholin-4-yl]-6-[[2-(trifluoromethyl)phenyl]sulfonylmethyl]pyrimidin-2-yl]aniline (PubChem CID 59379993) has the molecular formula C23H23F3N4O3S and a molecular weight of 492.52 g/mol. Its IUPAC name is 4-[4-[(3S)-3-methylmorpholin-4-yl]-6-[[2-(trifluoromethyl)phenyl]sulfonylmethyl]pyrimidin-2-yl]aniline.
| Compound Name | 4-[4-[(3S)-3-methylmorpholin-4-yl]-6-[[2-(trifluoromethyl)phenyl]sulfonylmethyl]pyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 59379993 |
| Molecular Formula | C23H23F3N4O3S |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 4-[4-[(3S)-3-methylmorpholin-4-yl]-6-[[2-(trifluoromethyl)phenyl]sulfonylmethyl]pyrimidin-2-yl]aniline |
| SMILES | C[C@H]1COCCN1c1cc(CS(=O)(=O)c2ccccc2C(F)(F)F)nc(-c2ccc(N)cc2)n1 |
| InChI | InChI=1S/C23H23F3N4O3S/c1-15-13-33-11-10-30(15)21-12-18(28-22(29-21)16-6-8-17(27)9-7-16)14-34(31,32)20-5-3-2-4-19(20)23(24,25)26/h2-9,12,15H,10-11,13-14,27H2,1H3/t15-/m0/s1 |
| InChIKey | ICWHOLUGYKOYNG-HNNXBMFYSA-N |
| XLogP | 3.94 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|