C40H44Cl2GeN2O2 — CID 59380717
(4R,9R)-16,22-ditert-butyl-19,19-dichloro-14,24-diphenyl-18,20-dioxa-3,10-diaza-19-germatetracyclo[19.4.0.04,9.012,17]pentacosa-1(21),2,10,12(17),13,15,22,24-octaene (PubChem CID 59380717) has the molecular formula C40H44Cl2GeN2O2 and a molecular weight of 728.32 g/mol. Its IUPAC name is (4R,9R)-16,22-ditert-butyl-19,19-dichloro-14,24-diphenyl-18,20-dioxa-3,10-diaza-19-germatetracyclo[19.4.0.04,9.012,17]pentacosa-1(21),2,10,12(17),13,15,22,24-octaene.
| Compound Name | (4R,9R)-16,22-ditert-butyl-19,19-dichloro-14,24-diphenyl-18,20-dioxa-3,10-diaza-19-germatetracyclo[19.4.0.04,9.012,17]pentacosa-1(21),2,10,12(17),13,15,22,24-octaene |
|---|---|
| PubChem CID | 59380717 |
| Molecular Formula | C40H44Cl2GeN2O2 |
| Molecular Weight | 728.32 g/mol |
| Exact Mass | 728.20 |
| IUPAC Name | (4R,9R)-16,22-ditert-butyl-19,19-dichloro-14,24-diphenyl-18,20-dioxa-3,10-diaza-19-germatetracyclo[19.4.0.04,9.012,17]pentacosa-1(21),2,10,12(17),13,15,22,24-octaene |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)cc2c1O[Ge](Cl)(Cl)Oc1c(cc(-c3ccccc3)cc1C(C)(C)C)/C=N/[C@@H]1CCCC[C@H]1/N=C/2 |
| InChI | InChI=1S/C40H44Cl2GeN2O2/c1-39(2,3)33-23-29(27-15-9-7-10-16-27)21-31-25-44-35-19-13-14-20-36(35)45-26-32-22-30(28-17-11-8-12-18-28)24-34(40(4,5)6)38(32)47-43(41,42)46-37(31)33/h7-12,15-18,21-26,35-36H,13-14,19-20H2,1-6H3/b44-25+,45-26+/t35-,36-/m1/s1 |
| InChIKey | FFOMTRSOLLTYOZ-QRLZJCSLSA-N |
| XLogP | 11.15 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.32 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |