About 1,3-dimethyl-4,5-dihydro-2H-imidazol-1-ium-2-ide
1,3-dimethyl-4,5-dihydro-2H-imidazol-1-ium-2-ide (PubChem CID 59380814) has the molecular formula C5H10N2
and a molecular weight of 98.15 g/mol. Its IUPAC name is 1,3-dimethyl-4,5-dihydro-2H-imidazol-1-ium-2-ide.
Molecular Properties
| Compound Name | 1,3-dimethyl-4,5-dihydro-2H-imidazol-1-ium-2-ide |
| PubChem CID | 59380814 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | 1,3-dimethyl-4,5-dihydro-2H-imidazol-1-ium-2-ide |
| SMILES | CN1[C-]=[N+](C)CC1 |
| InChI | InChI=1S/C5H10N2/c1-6-3-4-7(2)5-6/h3-4H2,1-2H3 |
| InChIKey | CFQXZFHOLVNEQO-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-4,5-dihydro-2H-imidazol-1-ium-2-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-4,5-dihydro-2H-imidazol-1-ium-2-ide?
The IUPAC name of 1,3-dimethyl-4,5-dihydro-2H-imidazol-1-ium-2-ide (CID 59380814) is 1,3-dimethyl-4,5-dihydro-2H-imidazol-1-ium-2-ide.
What is the SMILES notation for 1,3-dimethyl-4,5-dihydro-2H-imidazol-1-ium-2-ide?
The canonical SMILES for 1,3-dimethyl-4,5-dihydro-2H-imidazol-1-ium-2-ide is CN1[C-]=[N+](C)CC1.
What is the InChIKey of 1,3-dimethyl-4,5-dihydro-2H-imidazol-1-ium-2-ide?
The InChIKey is CFQXZFHOLVNEQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2/c1-6-3-4-7(2)5-6/h3-4H2,1-2H3.
What are the key properties of 1,3-dimethyl-4,5-dihydro-2H-imidazol-1-ium-2-ide?
1,3-dimethyl-4,5-dihydro-2H-imidazol-1-ium-2-ide has a molecular weight of 98.15 g/mol, XLogP of -0.52, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-4,5-dihydro-2H-imidazol-1-ium-2-ide is sourced from PubChem (CID 59380814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).