C10H18N4O — CID 59380883
N-(4,4-dimethylpentyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 59380883) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is N-(4,4-dimethylpentyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-(4,4-dimethylpentyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 59380883 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | N-(4,4-dimethylpentyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CC(C)(C)CCCNC(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C10H18N4O/c1-10(2,3)5-4-6-11-9(15)8-12-7-13-14-8/h7H,4-6H2,1-3H3,(H,11,15)(H,12,13,14) |
| InChIKey | HREALSCJPZRIBT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|