About [2-[(3R,4R)-4-(2-bromophenyl)-1-methylpyrrolidin-3-yl]-4-chlorophenyl] acetate
[2-[(3R,4R)-4-(2-bromophenyl)-1-methylpyrrolidin-3-yl]-4-chlorophenyl] acetate (PubChem CID 59381226) has the molecular formula C19H19BrClNO2
and a molecular weight of 408.72 g/mol. Its IUPAC name is [2-[(3R,4R)-4-(2-bromophenyl)-1-methylpyrrolidin-3-yl]-4-chlorophenyl] acetate.
Molecular Properties
| Compound Name | [2-[(3R,4R)-4-(2-bromophenyl)-1-methylpyrrolidin-3-yl]-4-chlorophenyl] acetate |
| PubChem CID | 59381226 |
| Molecular Formula | C19H19BrClNO2 |
| Molecular Weight | 408.72 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | [2-[(3R,4R)-4-(2-bromophenyl)-1-methylpyrrolidin-3-yl]-4-chlorophenyl] acetate |
| SMILES | CC(=O)Oc1ccc(Cl)cc1[C@@H]1CN(C)C[C@H]1c1ccccc1Br |
| InChI | InChI=1S/C19H19BrClNO2/c1-12(23)24-19-8-7-13(21)9-15(19)17-11-22(2)10-16(17)14-5-3-4-6-18(14)20/h3-9,16-17H,10-11H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | HSYVJWSHFFNGDL-IRXDYDNUSA-N |
| XLogP | 4.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.72 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-[(3R,4R)-4-(2-bromophenyl)-1-methylpyrrolidin-3-yl]-4-chlorophenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(3R,4R)-4-(2-bromophenyl)-1-methylpyrrolidin-3-yl]-4-chlorophenyl] acetate?
The IUPAC name of [2-[(3R,4R)-4-(2-bromophenyl)-1-methylpyrrolidin-3-yl]-4-chlorophenyl] acetate (CID 59381226) is [2-[(3R,4R)-4-(2-bromophenyl)-1-methylpyrrolidin-3-yl]-4-chlorophenyl] acetate.
What is the SMILES notation for [2-[(3R,4R)-4-(2-bromophenyl)-1-methylpyrrolidin-3-yl]-4-chlorophenyl] acetate?
The canonical SMILES for [2-[(3R,4R)-4-(2-bromophenyl)-1-methylpyrrolidin-3-yl]-4-chlorophenyl] acetate is CC(=O)Oc1ccc(Cl)cc1[C@@H]1CN(C)C[C@H]1c1ccccc1Br.
What is the InChIKey of [2-[(3R,4R)-4-(2-bromophenyl)-1-methylpyrrolidin-3-yl]-4-chlorophenyl] acetate?
The InChIKey is HSYVJWSHFFNGDL-IRXDYDNUSA-N. The full InChI is InChI=1S/C19H19BrClNO2/c1-12(23)24-19-8-7-13(21)9-15(19)17-11-22(2)10-16(17)14-5-3-4-6-18(14)20/h3-9,16-17H,10-11H2,1-2H3/t16-,17-/m0/s1.
What are the key properties of [2-[(3R,4R)-4-(2-bromophenyl)-1-methylpyrrolidin-3-yl]-4-chlorophenyl] acetate?
[2-[(3R,4R)-4-(2-bromophenyl)-1-methylpyrrolidin-3-yl]-4-chlorophenyl] acetate has a molecular weight of 408.72 g/mol, XLogP of 4.84, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(3R,4R)-4-(2-bromophenyl)-1-methylpyrrolidin-3-yl]-4-chlorophenyl] acetate is sourced from PubChem (CID 59381226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).