About [2-[(1,4-diethoxy-1,4-dioxobutan-2-yl)amino]-2-oxoethyl]azanium
[2-[(1,4-diethoxy-1,4-dioxobutan-2-yl)amino]-2-oxoethyl]azanium (PubChem CID 59381550) has the molecular formula C10H19N2O5+
and a molecular weight of 247.27 g/mol. Its IUPAC name is [2-[(1,4-diethoxy-1,4-dioxobutan-2-yl)amino]-2-oxoethyl]azanium.
Molecular Properties
| Compound Name | [2-[(1,4-diethoxy-1,4-dioxobutan-2-yl)amino]-2-oxoethyl]azanium |
| PubChem CID | 59381550 |
| Molecular Formula | C10H19N2O5+ |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | [2-[(1,4-diethoxy-1,4-dioxobutan-2-yl)amino]-2-oxoethyl]azanium |
| SMILES | CCOC(=O)CC(NC(=O)C[NH3+])C(=O)OCC |
| InChI | InChI=1S/C10H18N2O5/c1-3-16-9(14)5-7(10(15)17-4-2)12-8(13)6-11/h7H,3-6,11H2,1-2H3,(H,12,13)/p+1 |
| InChIKey | UCUDWKZWUOUPEF-UHFFFAOYSA-O |
| XLogP | -1.77 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(1,4-diethoxy-1,4-dioxobutan-2-yl)amino]-2-oxoethyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1,4-diethoxy-1,4-dioxobutan-2-yl)amino]-2-oxoethyl]azanium?
The IUPAC name of [2-[(1,4-diethoxy-1,4-dioxobutan-2-yl)amino]-2-oxoethyl]azanium (CID 59381550) is [2-[(1,4-diethoxy-1,4-dioxobutan-2-yl)amino]-2-oxoethyl]azanium.
What is the SMILES notation for [2-[(1,4-diethoxy-1,4-dioxobutan-2-yl)amino]-2-oxoethyl]azanium?
The canonical SMILES for [2-[(1,4-diethoxy-1,4-dioxobutan-2-yl)amino]-2-oxoethyl]azanium is CCOC(=O)CC(NC(=O)C[NH3+])C(=O)OCC.
What is the InChIKey of [2-[(1,4-diethoxy-1,4-dioxobutan-2-yl)amino]-2-oxoethyl]azanium?
The InChIKey is UCUDWKZWUOUPEF-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H18N2O5/c1-3-16-9(14)5-7(10(15)17-4-2)12-8(13)6-11/h7H,3-6,11H2,1-2H3,(H,12,13)/p+1.
What are the key properties of [2-[(1,4-diethoxy-1,4-dioxobutan-2-yl)amino]-2-oxoethyl]azanium?
[2-[(1,4-diethoxy-1,4-dioxobutan-2-yl)amino]-2-oxoethyl]azanium has a molecular weight of 247.27 g/mol, XLogP of -1.77, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1,4-diethoxy-1,4-dioxobutan-2-yl)amino]-2-oxoethyl]azanium is sourced from PubChem (CID 59381550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).