C23H35N — CID 59381629
(1Z,4E,6E,8E)-7-methyl-3-methylidene-N-propyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-1,4,6,8-tetraen-1-amine (PubChem CID 59381629) has the molecular formula C23H35N and a molecular weight of 325.54 g/mol. Its IUPAC name is (1Z,4E,6E,8E)-7-methyl-3-methylidene-N-propyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-1,4,6,8-tetraen-1-amine.
| Compound Name | (1Z,4E,6E,8E)-7-methyl-3-methylidene-N-propyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-1,4,6,8-tetraen-1-amine |
|---|---|
| PubChem CID | 59381629 |
| Molecular Formula | C23H35N |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.28 |
| IUPAC Name | (1Z,4E,6E,8E)-7-methyl-3-methylidene-N-propyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-1,4,6,8-tetraen-1-amine |
| SMILES | C=C(/C=C\NCCC)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C23H35N/c1-7-17-24-18-15-20(3)11-8-10-19(2)13-14-22-21(4)12-9-16-23(22,5)6/h8,10-11,13-15,18,24H,3,7,9,12,16-17H2,1-2,4-6H3/b11-8+,14-13+,18-15-,19-10+ |
| InChIKey | YSUFGQHGCGZJET-XBIPIPLWSA-N |
| XLogP | 6.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|