C17H22N2O3 — CID 59382052
methyl 3-[[4-(cyclopropanecarbonyl)piperazin-1-yl]methyl]benzoate (PubChem CID 59382052) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is methyl 3-[[4-(cyclopropanecarbonyl)piperazin-1-yl]methyl]benzoate.
| Compound Name | methyl 3-[[4-(cyclopropanecarbonyl)piperazin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 59382052 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | methyl 3-[[4-(cyclopropanecarbonyl)piperazin-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1cccc(CN2CCN(C(=O)C3CC3)CC2)c1 |
| InChI | InChI=1S/C17H22N2O3/c1-22-17(21)15-4-2-3-13(11-15)12-18-7-9-19(10-8-18)16(20)14-5-6-14/h2-4,11,14H,5-10,12H2,1H3 |
| InChIKey | BZKUELYXMPJHBQ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |