C22H23N3OS — CID 59382198
[3-methyl-4-(3-methylphenyl)piperazin-1-yl]-(5-pyridin-2-ylthiophen-2-yl)methanone (PubChem CID 59382198) has the molecular formula C22H23N3OS and a molecular weight of 377.51 g/mol. Its IUPAC name is [3-methyl-4-(3-methylphenyl)piperazin-1-yl]-(5-pyridin-2-ylthiophen-2-yl)methanone.
| Compound Name | [3-methyl-4-(3-methylphenyl)piperazin-1-yl]-(5-pyridin-2-ylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 59382198 |
| Molecular Formula | C22H23N3OS |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | [3-methyl-4-(3-methylphenyl)piperazin-1-yl]-(5-pyridin-2-ylthiophen-2-yl)methanone |
| SMILES | Cc1cccc(N2CCN(C(=O)c3ccc(-c4ccccn4)s3)CC2C)c1 |
| InChI | InChI=1S/C22H23N3OS/c1-16-6-5-7-18(14-16)25-13-12-24(15-17(25)2)22(26)21-10-9-20(27-21)19-8-3-4-11-23-19/h3-11,14,17H,12-13,15H2,1-2H3 |
| InChIKey | CMEORYRBRPNJBI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |