About 2,3-bis(bromomethyl)-1,4-difluorobenzene
2,3-bis(bromomethyl)-1,4-difluorobenzene (PubChem CID 59382290) has the molecular formula C8H6Br2F2
and a molecular weight of 299.94 g/mol. Its IUPAC name is 2,3-bis(bromomethyl)-1,4-difluorobenzene.
Molecular Properties
| Compound Name | 2,3-bis(bromomethyl)-1,4-difluorobenzene |
| PubChem CID | 59382290 |
| Molecular Formula | C8H6Br2F2 |
| Molecular Weight | 299.94 g/mol |
| Exact Mass | 297.88 |
| IUPAC Name | 2,3-bis(bromomethyl)-1,4-difluorobenzene |
| SMILES | Fc1ccc(F)c(CBr)c1CBr |
| InChI | InChI=1S/C8H6Br2F2/c9-3-5-6(4-10)8(12)2-1-7(5)11/h1-2H,3-4H2 |
| InChIKey | LLDRGWSZEFZZEF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.94 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(bromomethyl)-1,4-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(bromomethyl)-1,4-difluorobenzene?
The IUPAC name of 2,3-bis(bromomethyl)-1,4-difluorobenzene (CID 59382290) is 2,3-bis(bromomethyl)-1,4-difluorobenzene.
What is the SMILES notation for 2,3-bis(bromomethyl)-1,4-difluorobenzene?
The canonical SMILES for 2,3-bis(bromomethyl)-1,4-difluorobenzene is Fc1ccc(F)c(CBr)c1CBr.
What is the InChIKey of 2,3-bis(bromomethyl)-1,4-difluorobenzene?
The InChIKey is LLDRGWSZEFZZEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Br2F2/c9-3-5-6(4-10)8(12)2-1-7(5)11/h1-2H,3-4H2.
What are the key properties of 2,3-bis(bromomethyl)-1,4-difluorobenzene?
2,3-bis(bromomethyl)-1,4-difluorobenzene has a molecular weight of 299.94 g/mol, XLogP of 3.75, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(bromomethyl)-1,4-difluorobenzene is sourced from PubChem (CID 59382290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).