C8H13NO5 — CID 593823
2-O'-ethyl 2-O-methyl 1-methoxyaziridine-2,2-dicarboxylate (PubChem CID 593823) has the molecular formula C8H13NO5 and a molecular weight of 203.19 g/mol. Its IUPAC name is 2-O'-ethyl 2-O-methyl 1-methoxyaziridine-2,2-dicarboxylate.
| Compound Name | 2-O'-ethyl 2-O-methyl 1-methoxyaziridine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 593823 |
| Molecular Formula | C8H13NO5 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 2-O'-ethyl 2-O-methyl 1-methoxyaziridine-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OC)CN1OC |
| InChI | InChI=1S/C8H13NO5/c1-4-14-7(11)8(6(10)12-2)5-9(8)13-3/h4-5H2,1-3H3 |
| InChIKey | YBKHDKCTGGLSKM-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|