C10H9F3N2O — CID 59382308
1-(5-amino-1,3-dihydroisoindol-2-yl)-2,2,2-trifluoroethanone (PubChem CID 59382308) has the molecular formula C10H9F3N2O and a molecular weight of 230.19 g/mol. Its IUPAC name is 1-(5-amino-1,3-dihydroisoindol-2-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(5-amino-1,3-dihydroisoindol-2-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 59382308 |
| Molecular Formula | C10H9F3N2O |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 1-(5-amino-1,3-dihydroisoindol-2-yl)-2,2,2-trifluoroethanone |
| SMILES | Nc1ccc2c(c1)CN(C(=O)C(F)(F)F)C2 |
| InChI | InChI=1S/C10H9F3N2O/c11-10(12,13)9(16)15-4-6-1-2-8(14)3-7(6)5-15/h1-3H,4-5,14H2 |
| InChIKey | GLZWTOBGMDMQCW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|