C13H20N2O — CID 59382319
4-(2,3,3a,7a-tetrahydro-1H-isoindol-5-ylmethyl)morpholine (PubChem CID 59382319) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 4-(2,3,3a,7a-tetrahydro-1H-isoindol-5-ylmethyl)morpholine.
| Compound Name | 4-(2,3,3a,7a-tetrahydro-1H-isoindol-5-ylmethyl)morpholine |
|---|---|
| PubChem CID | 59382319 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 4-(2,3,3a,7a-tetrahydro-1H-isoindol-5-ylmethyl)morpholine |
| SMILES | C1=CC2CNCC2C=C1CN1CCOCC1 |
| InChI | InChI=1S/C13H20N2O/c1-2-12-8-14-9-13(12)7-11(1)10-15-3-5-16-6-4-15/h1-2,7,12-14H,3-6,8-10H2 |
| InChIKey | CJMFXBGQQUPYQS-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |