About tert-butyl N-[(2S)-1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]carbamate
tert-butyl N-[(2S)-1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]carbamate (PubChem CID 59382860) has the molecular formula C15H28F2N2O2
and a molecular weight of 306.40 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2S)-1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]carbamate |
| PubChem CID | 59382860 |
| Molecular Formula | C15H28F2N2O2 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | tert-butyl N-[(2S)-1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]carbamate |
| SMILES | CNC[C@H](CC1CCC(F)(F)CC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H28F2N2O2/c1-14(2,3)21-13(20)19-12(10-18-4)9-11-5-7-15(16,17)8-6-11/h11-12,18H,5-10H2,1-4H3,(H,19,20)/t12-/m0/s1 |
| InChIKey | HHZDHRDUKJNHBE-LBPRGKRZSA-N |
| XLogP | 3.31 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-[(2S)-1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2S)-1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[(2S)-1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]carbamate (CID 59382860) is tert-butyl N-[(2S)-1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(2S)-1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[(2S)-1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]carbamate is CNC[C@H](CC1CCC(F)(F)CC1)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(2S)-1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]carbamate?
The InChIKey is HHZDHRDUKJNHBE-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H28F2N2O2/c1-14(2,3)21-13(20)19-12(10-18-4)9-11-5-7-15(16,17)8-6-11/h11-12,18H,5-10H2,1-4H3,(H,19,20)/t12-/m0/s1.
What are the key properties of tert-butyl N-[(2S)-1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]carbamate?
tert-butyl N-[(2S)-1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]carbamate has a molecular weight of 306.40 g/mol, XLogP of 3.31, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2S)-1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]carbamate is sourced from PubChem (CID 59382860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).