C17H22N2O3 — CID 59383059
2-[(1S,2R)-1-cyclopentyl-1-hydroxy-3-(methylamino)propan-2-yl]isoindole-1,3-dione (PubChem CID 59383059) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 2-[(1S,2R)-1-cyclopentyl-1-hydroxy-3-(methylamino)propan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(1S,2R)-1-cyclopentyl-1-hydroxy-3-(methylamino)propan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 59383059 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 2-[(1S,2R)-1-cyclopentyl-1-hydroxy-3-(methylamino)propan-2-yl]isoindole-1,3-dione |
| SMILES | CNC[C@H]([C@@H](O)C1CCCC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H22N2O3/c1-18-10-14(15(20)11-6-2-3-7-11)19-16(21)12-8-4-5-9-13(12)17(19)22/h4-5,8-9,11,14-15,18,20H,2-3,6-7,10H2,1H3/t14-,15+/m1/s1 |
| InChIKey | OHXIKUHEDKCAPL-CABCVRRESA-N |
| XLogP | 1.42 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|