About 2-[4-[(2-chloro-4-fluorophenyl)-dihydroxy-λ4-sulfanyl]phenyl]-1,1,1-trifluoropropan-2-ol
2-[4-[(2-chloro-4-fluorophenyl)-dihydroxy-λ4-sulfanyl]phenyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 59383485) has the molecular formula C15H13ClF4O3S
and a molecular weight of 384.78 g/mol. Its IUPAC name is 2-[4-[(2-chloro-4-fluorophenyl)-dihydroxy-λ4-sulfanyl]phenyl]-1,1,1-trifluoropropan-2-ol.
Molecular Properties
| Compound Name | 2-[4-[(2-chloro-4-fluorophenyl)-dihydroxy-λ4-sulfanyl]phenyl]-1,1,1-trifluoropropan-2-ol |
| PubChem CID | 59383485 |
| Molecular Formula | C15H13ClF4O3S |
| Molecular Weight | 384.78 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | 2-[4-[(2-chloro-4-fluorophenyl)-dihydroxy-λ4-sulfanyl]phenyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | CC(O)(c1ccc(S(O)(O)c2ccc(F)cc2Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H13ClF4O3S/c1-14(21,15(18,19)20)9-2-5-11(6-3-9)24(22,23)13-7-4-10(17)8-12(13)16/h2-8,21-23H,1H3 |
| InChIKey | DIADNDPLMFGBGX-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.78 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-[(2-chloro-4-fluorophenyl)-dihydroxy-λ4-sulfanyl]phenyl]-1,1,1-trifluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(2-chloro-4-fluorophenyl)-dihydroxy-λ4-sulfanyl]phenyl]-1,1,1-trifluoropropan-2-ol?
The IUPAC name of 2-[4-[(2-chloro-4-fluorophenyl)-dihydroxy-λ4-sulfanyl]phenyl]-1,1,1-trifluoropropan-2-ol (CID 59383485) is 2-[4-[(2-chloro-4-fluorophenyl)-dihydroxy-λ4-sulfanyl]phenyl]-1,1,1-trifluoropropan-2-ol.
What is the SMILES notation for 2-[4-[(2-chloro-4-fluorophenyl)-dihydroxy-λ4-sulfanyl]phenyl]-1,1,1-trifluoropropan-2-ol?
The canonical SMILES for 2-[4-[(2-chloro-4-fluorophenyl)-dihydroxy-λ4-sulfanyl]phenyl]-1,1,1-trifluoropropan-2-ol is CC(O)(c1ccc(S(O)(O)c2ccc(F)cc2Cl)cc1)C(F)(F)F.
What is the InChIKey of 2-[4-[(2-chloro-4-fluorophenyl)-dihydroxy-λ4-sulfanyl]phenyl]-1,1,1-trifluoropropan-2-ol?
The InChIKey is DIADNDPLMFGBGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClF4O3S/c1-14(21,15(18,19)20)9-2-5-11(6-3-9)24(22,23)13-7-4-10(17)8-12(13)16/h2-8,21-23H,1H3.
What are the key properties of 2-[4-[(2-chloro-4-fluorophenyl)-dihydroxy-λ4-sulfanyl]phenyl]-1,1,1-trifluoropropan-2-ol?
2-[4-[(2-chloro-4-fluorophenyl)-dihydroxy-λ4-sulfanyl]phenyl]-1,1,1-trifluoropropan-2-ol has a molecular weight of 384.78 g/mol, XLogP of 5.42, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(2-chloro-4-fluorophenyl)-dihydroxy-λ4-sulfanyl]phenyl]-1,1,1-trifluoropropan-2-ol is sourced from PubChem (CID 59383485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).