C23H42N2O4 — CID 59383604
N-(2-ethyl-4,5,6-trimethyloxan-3-yl)-N'-(6-ethyl-3,4,5-trimethyloxan-2-yl)propanediamide (PubChem CID 59383604) has the molecular formula C23H42N2O4 and a molecular weight of 410.60 g/mol. Its IUPAC name is N-(2-ethyl-4,5,6-trimethyloxan-3-yl)-N'-(6-ethyl-3,4,5-trimethyloxan-2-yl)propanediamide.
| Compound Name | N-(2-ethyl-4,5,6-trimethyloxan-3-yl)-N'-(6-ethyl-3,4,5-trimethyloxan-2-yl)propanediamide |
|---|---|
| PubChem CID | 59383604 |
| Molecular Formula | C23H42N2O4 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.31 |
| IUPAC Name | N-(2-ethyl-4,5,6-trimethyloxan-3-yl)-N'-(6-ethyl-3,4,5-trimethyloxan-2-yl)propanediamide |
| SMILES | CCC1OC(NC(=O)CC(=O)NC2C(CC)OC(C)C(C)C2C)C(C)C(C)C1C |
| InChI | InChI=1S/C23H42N2O4/c1-9-18-14(5)12(3)16(7)23(29-18)25-21(27)11-20(26)24-22-15(6)13(4)17(8)28-19(22)10-2/h12-19,22-23H,9-11H2,1-8H3,(H,24,26)(H,25,27) |
| InChIKey | VNBXNUNLJSRHII-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|