C20H36O8 — CID 59383607
3-O-butyl 1-O,5-O-bis(2-hydroxyethyl) 1,3-dimethylheptane-1,3,5-tricarboxylate (PubChem CID 59383607) has the molecular formula C20H36O8 and a molecular weight of 404.50 g/mol. Its IUPAC name is 3-O-butyl 1-O,5-O-bis(2-hydroxyethyl) 1,3-dimethylheptane-1,3,5-tricarboxylate.
| Compound Name | 3-O-butyl 1-O,5-O-bis(2-hydroxyethyl) 1,3-dimethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 59383607 |
| Molecular Formula | C20H36O8 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 3-O-butyl 1-O,5-O-bis(2-hydroxyethyl) 1,3-dimethylheptane-1,3,5-tricarboxylate |
| SMILES | CCCCOC(=O)C(C)(CC(C)C(=O)OCCO)CC(CC)C(=O)OCCO |
| InChI | InChI=1S/C20H36O8/c1-5-7-10-28-19(25)20(4,13-15(3)17(23)26-11-8-21)14-16(6-2)18(24)27-12-9-22/h15-16,21-22H,5-14H2,1-4H3 |
| InChIKey | CKKNZUPHZMLNGB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|