C16H30F5NO — CID 59383783
N-butyl-N-[2-(1,1,1,2,2-pentafluoro-4-methylpentan-3-yl)oxyethyl]butan-1-amine (PubChem CID 59383783) has the molecular formula C16H30F5NO and a molecular weight of 347.41 g/mol. Its IUPAC name is N-butyl-N-[2-(1,1,1,2,2-pentafluoro-4-methylpentan-3-yl)oxyethyl]butan-1-amine.
| Compound Name | N-butyl-N-[2-(1,1,1,2,2-pentafluoro-4-methylpentan-3-yl)oxyethyl]butan-1-amine |
|---|---|
| PubChem CID | 59383783 |
| Molecular Formula | C16H30F5NO |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | N-butyl-N-[2-(1,1,1,2,2-pentafluoro-4-methylpentan-3-yl)oxyethyl]butan-1-amine |
| SMILES | CCCCN(CCCC)CCOC(C(C)C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H30F5NO/c1-5-7-9-22(10-8-6-2)11-12-23-14(13(3)4)15(17,18)16(19,20)21/h13-14H,5-12H2,1-4H3 |
| InChIKey | NAXLKVGPCVXYFK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|