C15H28F5NO — CID 59383789
N-[2-(2,2,3,3,3-pentafluoropropoxy)ethyl]-N-pentylpentan-1-amine (PubChem CID 59383789) has the molecular formula C15H28F5NO and a molecular weight of 333.39 g/mol. Its IUPAC name is N-[2-(2,2,3,3,3-pentafluoropropoxy)ethyl]-N-pentylpentan-1-amine.
| Compound Name | N-[2-(2,2,3,3,3-pentafluoropropoxy)ethyl]-N-pentylpentan-1-amine |
|---|---|
| PubChem CID | 59383789 |
| Molecular Formula | C15H28F5NO |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | N-[2-(2,2,3,3,3-pentafluoropropoxy)ethyl]-N-pentylpentan-1-amine |
| SMILES | CCCCCN(CCCCC)CCOCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H28F5NO/c1-3-5-7-9-21(10-8-6-4-2)11-12-22-13-14(16,17)15(18,19)20/h3-13H2,1-2H3 |
| InChIKey | BQXMPDAEKZSAGW-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|