C18H31F8NO — CID 59383793
N-butyl-N-[2-(4,4,5,5,6,6,7,7-octafluoro-2-methylheptan-3-yl)oxyethyl]butan-1-amine (PubChem CID 59383793) has the molecular formula C18H31F8NO and a molecular weight of 429.44 g/mol. Its IUPAC name is N-butyl-N-[2-(4,4,5,5,6,6,7,7-octafluoro-2-methylheptan-3-yl)oxyethyl]butan-1-amine.
| Compound Name | N-butyl-N-[2-(4,4,5,5,6,6,7,7-octafluoro-2-methylheptan-3-yl)oxyethyl]butan-1-amine |
|---|---|
| PubChem CID | 59383793 |
| Molecular Formula | C18H31F8NO |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | N-butyl-N-[2-(4,4,5,5,6,6,7,7-octafluoro-2-methylheptan-3-yl)oxyethyl]butan-1-amine |
| SMILES | CCCCN(CCCC)CCOC(C(C)C)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C18H31F8NO/c1-5-7-9-27(10-8-6-2)11-12-28-14(13(3)4)16(21,22)18(25,26)17(23,24)15(19)20/h13-15H,5-12H2,1-4H3 |
| InChIKey | AHYDUYCTUYRLJJ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|