C17H32F5NO — CID 59383798
N-hexyl-N-[2-(2,2,3,3,3-pentafluoropropoxy)ethyl]hexan-1-amine (PubChem CID 59383798) has the molecular formula C17H32F5NO and a molecular weight of 361.44 g/mol. Its IUPAC name is N-hexyl-N-[2-(2,2,3,3,3-pentafluoropropoxy)ethyl]hexan-1-amine.
| Compound Name | N-hexyl-N-[2-(2,2,3,3,3-pentafluoropropoxy)ethyl]hexan-1-amine |
|---|---|
| PubChem CID | 59383798 |
| Molecular Formula | C17H32F5NO |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | N-hexyl-N-[2-(2,2,3,3,3-pentafluoropropoxy)ethyl]hexan-1-amine |
| SMILES | CCCCCCN(CCCCCC)CCOCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H32F5NO/c1-3-5-7-9-11-23(12-10-8-6-4-2)13-14-24-15-16(18,19)17(20,21)22/h3-15H2,1-2H3 |
| InChIKey | JXURVLKVPOIBMR-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|