C21H30F3N2O5PS — CID 59384375
[(2S)-2-amino-2-[5-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propyl] dihydrogen phosphate (PubChem CID 59384375) has the molecular formula C21H30F3N2O5PS and a molecular weight of 510.52 g/mol. Its IUPAC name is [(2S)-2-amino-2-[5-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propyl] dihydrogen phosphate.
| Compound Name | [(2S)-2-amino-2-[5-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 59384375 |
| Molecular Formula | C21H30F3N2O5PS |
| Molecular Weight | 510.52 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | [(2S)-2-amino-2-[5-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propyl] dihydrogen phosphate |
| SMILES | CCCCCCCCOc1ccc(-c2cnc([C@@](C)(N)COP(=O)(O)O)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H30F3N2O5PS/c1-3-4-5-6-7-8-11-30-17-10-9-15(12-16(17)21(22,23)24)18-13-26-19(33-18)20(2,25)14-31-32(27,28)29/h9-10,12-13H,3-8,11,14,25H2,1-2H3,(H2,27,28,29)/t20-/m0/s1 |
| InChIKey | JYIWELIWYZVXHB-FQEVSTJZSA-N |
| XLogP | 5.85 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.52 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|