About 2-[4-(5-chlorothiophen-2-yl)-2-(6-methoxy-3-pyridinyl)-1,3-thiazol-5-yl]acetate
2-[4-(5-chlorothiophen-2-yl)-2-(6-methoxy-3-pyridinyl)-1,3-thiazol-5-yl]acetate (PubChem CID 59384613) has the molecular formula C15H10ClN2O3S2-
and a molecular weight of 365.84 g/mol. Its IUPAC name is 2-[4-(5-chlorothiophen-2-yl)-2-(6-methoxy-3-pyridinyl)-1,3-thiazol-5-yl]acetate.
Molecular Properties
| Compound Name | 2-[4-(5-chlorothiophen-2-yl)-2-(6-methoxy-3-pyridinyl)-1,3-thiazol-5-yl]acetate |
| PubChem CID | 59384613 |
| Molecular Formula | C15H10ClN2O3S2- |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | 2-[4-(5-chlorothiophen-2-yl)-2-(6-methoxy-3-pyridinyl)-1,3-thiazol-5-yl]acetate |
| SMILES | COc1ccc(-c2nc(-c3ccc(Cl)s3)c(CC(=O)[O-])s2)cn1 |
| InChI | InChI=1S/C15H11ClN2O3S2/c1-21-12-5-2-8(7-17-12)15-18-14(9-3-4-11(16)22-9)10(23-15)6-13(19)20/h2-5,7H,6H2,1H3,(H,19,20)/p-1 |
| InChIKey | XROZDUPRSONPRJ-UHFFFAOYSA-M |
| XLogP | 2.89 |
| TPSA | 75.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[4-(5-chlorothiophen-2-yl)-2-(6-methoxy-3-pyridinyl)-1,3-thiazol-5-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(5-chlorothiophen-2-yl)-2-(6-methoxy-3-pyridinyl)-1,3-thiazol-5-yl]acetate?
The IUPAC name of 2-[4-(5-chlorothiophen-2-yl)-2-(6-methoxy-3-pyridinyl)-1,3-thiazol-5-yl]acetate (CID 59384613) is 2-[4-(5-chlorothiophen-2-yl)-2-(6-methoxy-3-pyridinyl)-1,3-thiazol-5-yl]acetate.
What is the SMILES notation for 2-[4-(5-chlorothiophen-2-yl)-2-(6-methoxy-3-pyridinyl)-1,3-thiazol-5-yl]acetate?
The canonical SMILES for 2-[4-(5-chlorothiophen-2-yl)-2-(6-methoxy-3-pyridinyl)-1,3-thiazol-5-yl]acetate is COc1ccc(-c2nc(-c3ccc(Cl)s3)c(CC(=O)[O-])s2)cn1.
What is the InChIKey of 2-[4-(5-chlorothiophen-2-yl)-2-(6-methoxy-3-pyridinyl)-1,3-thiazol-5-yl]acetate?
The InChIKey is XROZDUPRSONPRJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H11ClN2O3S2/c1-21-12-5-2-8(7-17-12)15-18-14(9-3-4-11(16)22-9)10(23-15)6-13(19)20/h2-5,7H,6H2,1H3,(H,19,20)/p-1.
What are the key properties of 2-[4-(5-chlorothiophen-2-yl)-2-(6-methoxy-3-pyridinyl)-1,3-thiazol-5-yl]acetate?
2-[4-(5-chlorothiophen-2-yl)-2-(6-methoxy-3-pyridinyl)-1,3-thiazol-5-yl]acetate has a molecular weight of 365.84 g/mol, XLogP of 2.89, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(5-chlorothiophen-2-yl)-2-(6-methoxy-3-pyridinyl)-1,3-thiazol-5-yl]acetate is sourced from PubChem (CID 59384613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).